C28H35N3O3 — CID 46524510
(E)-1-[4-[4-[(4-methoxyphenyl)methyl]-1,4-diazepane-1-carbonyl]piperidin-1-yl]-3-phenylprop-2-en-1-one (PubChem CID 46524510) has the molecular formula C28H35N3O3 and a molecular weight of 461.61 g/mol. Its IUPAC name is (E)-1-[4-[4-[(4-methoxyphenyl)methyl]-1,4-diazepane-1-carbonyl]piperidin-1-yl]-3-phenylprop-2-en-1-one.
| Compound Name | (E)-1-[4-[4-[(4-methoxyphenyl)methyl]-1,4-diazepane-1-carbonyl]piperidin-1-yl]-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 46524510 |
| Molecular Formula | C28H35N3O3 |
| Molecular Weight | 461.61 g/mol |
| Exact Mass | 461.27 |
| IUPAC Name | (E)-1-[4-[4-[(4-methoxyphenyl)methyl]-1,4-diazepane-1-carbonyl]piperidin-1-yl]-3-phenylprop-2-en-1-one |
| SMILES | COc1ccc(CN2CCCN(C(=O)C3CCN(C(=O)/C=C/c4ccccc4)CC3)CC2)cc1 |
| InChI | InChI=1S/C28H35N3O3/c1-34-26-11-8-24(9-12-26)22-29-16-5-17-31(21-20-29)28(33)25-14-18-30(19-15-25)27(32)13-10-23-6-3-2-4-7-23/h2-4,6-13,25H,5,14-22H2,1H3/b13-10+ |
| InChIKey | RLFHCIPVRZLUJP-JLHYYAGUSA-N |
| XLogP | 3.68 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.61 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|