C19H23N2OS+ — CID 9181591
(E)-3-(3-methylphenyl)-1-[4-(thiophen-3-ylmethyl)piperazin-4-ium-1-yl]prop-2-en-1-one (PubChem CID 9181591) has the molecular formula C19H23N2OS+ and a molecular weight of 327.47 g/mol. Its IUPAC name is (E)-3-(3-methylphenyl)-1-[4-(thiophen-3-ylmethyl)piperazin-4-ium-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(3-methylphenyl)-1-[4-(thiophen-3-ylmethyl)piperazin-4-ium-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 9181591 |
| Molecular Formula | C19H23N2OS+ |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | (E)-3-(3-methylphenyl)-1-[4-(thiophen-3-ylmethyl)piperazin-4-ium-1-yl]prop-2-en-1-one |
| SMILES | Cc1cccc(/C=C/C(=O)N2CC[NH+](Cc3ccsc3)CC2)c1 |
| InChI | InChI=1S/C19H22N2OS/c1-16-3-2-4-17(13-16)5-6-19(22)21-10-8-20(9-11-21)14-18-7-12-23-15-18/h2-7,12-13,15H,8-11,14H2,1H3/p+1/b6-5+ |
| InChIKey | UTCDCZCGXAQOMG-AATRIKPKSA-O |
| XLogP | 2.00 |
| TPSA | 24.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|