C18H20ClN2OS+ — CID 9180615
(E)-3-(3-chlorophenyl)-1-[4-(thiophen-3-ylmethyl)piperazin-4-ium-1-yl]prop-2-en-1-one (PubChem CID 9180615) has the molecular formula C18H20ClN2OS+ and a molecular weight of 347.89 g/mol. Its IUPAC name is (E)-3-(3-chlorophenyl)-1-[4-(thiophen-3-ylmethyl)piperazin-4-ium-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(3-chlorophenyl)-1-[4-(thiophen-3-ylmethyl)piperazin-4-ium-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 9180615 |
| Molecular Formula | C18H20ClN2OS+ |
| Molecular Weight | 347.89 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | (E)-3-(3-chlorophenyl)-1-[4-(thiophen-3-ylmethyl)piperazin-4-ium-1-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1cccc(Cl)c1)N1CC[NH+](Cc2ccsc2)CC1 |
| InChI | InChI=1S/C18H19ClN2OS/c19-17-3-1-2-15(12-17)4-5-18(22)21-9-7-20(8-10-21)13-16-6-11-23-14-16/h1-6,11-12,14H,7-10,13H2/p+1/b5-4+ |
| InChIKey | RYASTVBAPAZUGI-SNAWJCMRSA-O |
| XLogP | 2.34 |
| TPSA | 24.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.89 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|