C18H18Cl2N2OS — CID 9181094
(E)-3-(3,4-dichlorophenyl)-1-[4-(thiophen-3-ylmethyl)piperazin-1-yl]prop-2-en-1-one (PubChem CID 9181094) has the molecular formula C18H18Cl2N2OS and a molecular weight of 381.33 g/mol. Its IUPAC name is (E)-3-(3,4-dichlorophenyl)-1-[4-(thiophen-3-ylmethyl)piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(3,4-dichlorophenyl)-1-[4-(thiophen-3-ylmethyl)piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 9181094 |
| Molecular Formula | C18H18Cl2N2OS |
| Molecular Weight | 381.33 g/mol |
| Exact Mass | 380.05 |
| IUPAC Name | (E)-3-(3,4-dichlorophenyl)-1-[4-(thiophen-3-ylmethyl)piperazin-1-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(Cl)c(Cl)c1)N1CCN(Cc2ccsc2)CC1 |
| InChI | InChI=1S/C18H18Cl2N2OS/c19-16-3-1-14(11-17(16)20)2-4-18(23)22-8-6-21(7-9-22)12-15-5-10-24-13-15/h1-5,10-11,13H,6-9,12H2/b4-2+ |
| InChIKey | UGYZHTORNAYKEM-DUXPYHPUSA-N |
| XLogP | 4.41 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.33 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|