C15H15Cl2NO — CID 56537880
(E)-3-(3,4-dichlorophenyl)-1-(4-methylidenepiperidin-1-yl)prop-2-en-1-one (PubChem CID 56537880) has the molecular formula C15H15Cl2NO and a molecular weight of 296.20 g/mol. Its IUPAC name is (E)-3-(3,4-dichlorophenyl)-1-(4-methylidenepiperidin-1-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(3,4-dichlorophenyl)-1-(4-methylidenepiperidin-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 56537880 |
| Molecular Formula | C15H15Cl2NO |
| Molecular Weight | 296.20 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | (E)-3-(3,4-dichlorophenyl)-1-(4-methylidenepiperidin-1-yl)prop-2-en-1-one |
| SMILES | C=C1CCN(C(=O)/C=C/c2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C15H15Cl2NO/c1-11-6-8-18(9-7-11)15(19)5-3-12-2-4-13(16)14(17)10-12/h2-5,10H,1,6-9H2/b5-3+ |
| InChIKey | JWAAAXGGGUMGMP-HWKANZROSA-N |
| XLogP | 4.19 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.20 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|