C17H18Cl2N2O3 — CID 90879180
1-[3-(3,4-dichlorophenyl)prop-2-enoyl]-4-(oxiran-2-ylmethyl)-1,4-diazepan-5-one (PubChem CID 90879180) has the molecular formula C17H18Cl2N2O3 and a molecular weight of 369.25 g/mol. Its IUPAC name is 1-[3-(3,4-dichlorophenyl)prop-2-enoyl]-4-(oxiran-2-ylmethyl)-1,4-diazepan-5-one.
| Compound Name | 1-[3-(3,4-dichlorophenyl)prop-2-enoyl]-4-(oxiran-2-ylmethyl)-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 90879180 |
| Molecular Formula | C17H18Cl2N2O3 |
| Molecular Weight | 369.25 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | 1-[3-(3,4-dichlorophenyl)prop-2-enoyl]-4-(oxiran-2-ylmethyl)-1,4-diazepan-5-one |
| SMILES | O=C(C=Cc1ccc(Cl)c(Cl)c1)N1CCC(=O)N(CC2CO2)CC1 |
| InChI | InChI=1S/C17H18Cl2N2O3/c18-14-3-1-12(9-15(14)19)2-4-16(22)20-6-5-17(23)21(8-7-20)10-13-11-24-13/h1-4,9,13H,5-8,10-11H2 |
| InChIKey | AMDASTOQQWBGAV-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 53.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.25 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|