C18H22Cl2N2O2 — CID 55337875
(E)-3-(3,4-dichlorophenyl)-1-[4-(oxolan-2-ylmethyl)piperazin-1-yl]prop-2-en-1-one (PubChem CID 55337875) has the molecular formula C18H22Cl2N2O2 and a molecular weight of 369.29 g/mol. Its IUPAC name is (E)-3-(3,4-dichlorophenyl)-1-[4-(oxolan-2-ylmethyl)piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(3,4-dichlorophenyl)-1-[4-(oxolan-2-ylmethyl)piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 55337875 |
| Molecular Formula | C18H22Cl2N2O2 |
| Molecular Weight | 369.29 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | (E)-3-(3,4-dichlorophenyl)-1-[4-(oxolan-2-ylmethyl)piperazin-1-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(Cl)c(Cl)c1)N1CCN(CC2CCCO2)CC1 |
| InChI | InChI=1S/C18H22Cl2N2O2/c19-16-5-3-14(12-17(16)20)4-6-18(23)22-9-7-21(8-10-22)13-15-2-1-11-24-15/h3-6,12,15H,1-2,7-11,13H2/b6-4+ |
| InChIKey | KBRKUZNEASOGMJ-GQCTYLIASA-N |
| XLogP | 3.33 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.29 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|