C17H20Cl2N2O2 — CID 172711510
(E)-3-(3,4-dichlorophenyl)-1-[4-(oxiran-2-ylmethyl)-1,4-diazepan-1-yl]prop-2-en-1-one (PubChem CID 172711510) has the molecular formula C17H20Cl2N2O2 and a molecular weight of 355.26 g/mol. Its IUPAC name is (E)-3-(3,4-dichlorophenyl)-1-[4-(oxiran-2-ylmethyl)-1,4-diazepan-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(3,4-dichlorophenyl)-1-[4-(oxiran-2-ylmethyl)-1,4-diazepan-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 172711510 |
| Molecular Formula | C17H20Cl2N2O2 |
| Molecular Weight | 355.26 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | (E)-3-(3,4-dichlorophenyl)-1-[4-(oxiran-2-ylmethyl)-1,4-diazepan-1-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(Cl)c(Cl)c1)N1CCCN(CC2CO2)CC1 |
| InChI | InChI=1S/C17H20Cl2N2O2/c18-15-4-2-13(10-16(15)19)3-5-17(22)21-7-1-6-20(8-9-21)11-14-12-23-14/h2-5,10,14H,1,6-9,11-12H2/b5-3+ |
| InChIKey | FHSAWVXVFBAHQE-HWKANZROSA-N |
| XLogP | 2.94 |
| TPSA | 36.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.26 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|