C13H13Cl2NO3 — CID 79410291
3-(3,4-dichlorophenyl)-1-[(3R,4S)-3,4-dihydroxypyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 79410291) has the molecular formula C13H13Cl2NO3 and a molecular weight of 302.16 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-1-[(3R,4S)-3,4-dihydroxypyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | 3-(3,4-dichlorophenyl)-1-[(3R,4S)-3,4-dihydroxypyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 79410291 |
| Molecular Formula | C13H13Cl2NO3 |
| Molecular Weight | 302.16 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-1-[(3R,4S)-3,4-dihydroxypyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | O=C(C=Cc1ccc(Cl)c(Cl)c1)N1C[C@@H](O)[C@@H](O)C1 |
| InChI | InChI=1S/C13H13Cl2NO3/c14-9-3-1-8(5-10(9)15)2-4-13(19)16-6-11(17)12(18)7-16/h1-5,11-12,17-18H,6-7H2/t11-,12+ |
| InChIKey | JRBVMBRBAULGAS-TXEJJXNPSA-N |
| XLogP | 1.57 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.16 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|