C14H17Cl2N2O+ — CID 7893084
(E)-3-(3,4-dichlorophenyl)-1-(4-methylpiperazin-4-ium-1-yl)prop-2-en-1-one (PubChem CID 7893084) has the molecular formula C14H17Cl2N2O+ and a molecular weight of 300.21 g/mol. Its IUPAC name is (E)-3-(3,4-dichlorophenyl)-1-(4-methylpiperazin-4-ium-1-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(3,4-dichlorophenyl)-1-(4-methylpiperazin-4-ium-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 7893084 |
| Molecular Formula | C14H17Cl2N2O+ |
| Molecular Weight | 300.21 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | (E)-3-(3,4-dichlorophenyl)-1-(4-methylpiperazin-4-ium-1-yl)prop-2-en-1-one |
| SMILES | C[NH+]1CCN(C(=O)/C=C/c2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C14H16Cl2N2O/c1-17-6-8-18(9-7-17)14(19)5-3-11-2-4-12(15)13(16)10-11/h2-5,10H,6-9H2,1H3/p+1/b5-3+ |
| InChIKey | UQMBBVJONOMWES-HWKANZROSA-O |
| XLogP | 1.36 |
| TPSA | 24.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.21 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|