C14H14Cl2N2O2 — CID 95139544
(3S)-1-[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]pyrrolidine-3-carboxamide (PubChem CID 95139544) has the molecular formula C14H14Cl2N2O2 and a molecular weight of 313.18 g/mol. Its IUPAC name is (3S)-1-[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]pyrrolidine-3-carboxamide.
| Compound Name | (3S)-1-[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 95139544 |
| Molecular Formula | C14H14Cl2N2O2 |
| Molecular Weight | 313.18 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | (3S)-1-[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]pyrrolidine-3-carboxamide |
| SMILES | NC(=O)[C@H]1CCN(C(=O)/C=C/c2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C14H14Cl2N2O2/c15-11-3-1-9(7-12(11)16)2-4-13(19)18-6-5-10(8-18)14(17)20/h1-4,7,10H,5-6,8H2,(H2,17,20)/b4-2+/t10-/m0/s1 |
| InChIKey | VFMOWTZIDIPPRP-YWNRKNDBSA-N |
| XLogP | 2.34 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.18 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|