C16H19Cl2NO — CID 6016233
(E)-3-(3,4-dichlorophenyl)-1-(2,6-dimethylpiperidin-1-yl)prop-2-en-1-one (PubChem CID 6016233) has the molecular formula C16H19Cl2NO and a molecular weight of 312.24 g/mol. Its IUPAC name is (E)-3-(3,4-dichlorophenyl)-1-(2,6-dimethylpiperidin-1-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(3,4-dichlorophenyl)-1-(2,6-dimethylpiperidin-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 6016233 |
| Molecular Formula | C16H19Cl2NO |
| Molecular Weight | 312.24 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | (E)-3-(3,4-dichlorophenyl)-1-(2,6-dimethylpiperidin-1-yl)prop-2-en-1-one |
| SMILES | CC1CCCC(C)N1C(=O)/C=C/c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H19Cl2NO/c1-11-4-3-5-12(2)19(11)16(20)9-7-13-6-8-14(17)15(18)10-13/h6-12H,3-5H2,1-2H3/b9-7+ |
| InChIKey | BKEFGBRKFZYXCT-VQHVLOKHSA-N |
| XLogP | 4.80 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.24 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|