C17H22Cl3NO — CID 10021574
(E)-1-(3,4-dichlorophenyl)-4-methyl-4-piperidin-1-ylpent-1-en-3-one;hydrochloride (PubChem CID 10021574) has the molecular formula C17H22Cl3NO and a molecular weight of 362.73 g/mol. Its IUPAC name is (E)-1-(3,4-dichlorophenyl)-4-methyl-4-piperidin-1-ylpent-1-en-3-one;hydrochloride.
| Compound Name | (E)-1-(3,4-dichlorophenyl)-4-methyl-4-piperidin-1-ylpent-1-en-3-one;hydrochloride |
|---|---|
| PubChem CID | 10021574 |
| Molecular Formula | C17H22Cl3NO |
| Molecular Weight | 362.73 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | (E)-1-(3,4-dichlorophenyl)-4-methyl-4-piperidin-1-ylpent-1-en-3-one;hydrochloride |
| SMILES | CC(C)(C(=O)/C=C/c1ccc(Cl)c(Cl)c1)N1CCCCC1.Cl |
| InChI | InChI=1S/C17H21Cl2NO.ClH/c1-17(2,20-10-4-3-5-11-20)16(21)9-7-13-6-8-14(18)15(19)12-13;/h6-9,12H,3-5,10-11H2,1-2H3;1H/b9-7+; |
| InChIKey | LEHWBNNBDLPNTD-BXTVWIJMSA-N |
| XLogP | 5.26 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.73 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|