C37H48Cl4N6O — CID 99669425
1,3-bis[(Z)-[(Z)-1-(3,4-dichlorophenyl)-4,4-dimethyl-5-piperidin-1-ylpent-1-en-3-ylidene]amino]urea (PubChem CID 99669425) has the molecular formula C37H48Cl4N6O and a molecular weight of 734.64 g/mol. Its IUPAC name is 1,3-bis[(Z)-[(Z)-1-(3,4-dichlorophenyl)-4,4-dimethyl-5-piperidin-1-ylpent-1-en-3-ylidene]amino]urea.
| Compound Name | 1,3-bis[(Z)-[(Z)-1-(3,4-dichlorophenyl)-4,4-dimethyl-5-piperidin-1-ylpent-1-en-3-ylidene]amino]urea |
|---|---|
| PubChem CID | 99669425 |
| Molecular Formula | C37H48Cl4N6O |
| Molecular Weight | 734.64 g/mol |
| Exact Mass | 732.26 |
| IUPAC Name | 1,3-bis[(Z)-[(Z)-1-(3,4-dichlorophenyl)-4,4-dimethyl-5-piperidin-1-ylpent-1-en-3-ylidene]amino]urea |
| SMILES | CC(C)(CN1CCCCC1)C(/C=C\c1ccc(Cl)c(Cl)c1)=N\NC(=O)N/N=C(/C=C\c1ccc(Cl)c(Cl)c1)C(C)(C)CN1CCCCC1 |
| InChI | InChI=1S/C37H48Cl4N6O/c1-36(2,25-46-19-7-5-8-20-46)33(17-13-27-11-15-29(38)31(40)23-27)42-44-35(48)45-43-34(18-14-28-12-16-30(39)32(41)24-28)37(3,4)26-47-21-9-6-10-22-47/h11-18,23-24H,5-10,19-22,25-26H2,1-4H3,(H2,44,45,48)/b17-13-,18-14-,42-33-,43-34- |
| InChIKey | AOKCOMHWNQKAIN-JIRYUTIXSA-N |
| XLogP | 10.06 |
| TPSA | 72.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.64 |
| LogP ≤ 5 | 10.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|