C37H50Cl2N6O — CID 6331445
1,3-bis[(Z)-[1-(4-chlorophenyl)-4,4-dimethyl-5-piperidin-1-ylpent-1-en-3-ylidene]amino]urea (PubChem CID 6331445) has the molecular formula C37H50Cl2N6O and a molecular weight of 665.75 g/mol. Its IUPAC name is 1,3-bis[(Z)-[1-(4-chlorophenyl)-4,4-dimethyl-5-piperidin-1-ylpent-1-en-3-ylidene]amino]urea.
| Compound Name | 1,3-bis[(Z)-[1-(4-chlorophenyl)-4,4-dimethyl-5-piperidin-1-ylpent-1-en-3-ylidene]amino]urea |
|---|---|
| PubChem CID | 6331445 |
| Molecular Formula | C37H50Cl2N6O |
| Molecular Weight | 665.75 g/mol |
| Exact Mass | 664.34 |
| IUPAC Name | 1,3-bis[(Z)-[1-(4-chlorophenyl)-4,4-dimethyl-5-piperidin-1-ylpent-1-en-3-ylidene]amino]urea |
| SMILES | CC(C)(CN1CCCCC1)/C(C=Cc1ccc(Cl)cc1)=N\NC(=O)N/N=C(/C=Cc1ccc(Cl)cc1)C(C)(C)CN1CCCCC1 |
| InChI | InChI=1S/C37H50Cl2N6O/c1-36(2,27-44-23-7-5-8-24-44)33(21-15-29-11-17-31(38)18-12-29)40-42-35(46)43-41-34(22-16-30-13-19-32(39)20-14-30)37(3,4)28-45-25-9-6-10-26-45/h11-22H,5-10,23-28H2,1-4H3,(H2,42,43,46)/b21-15?,22-16?,40-33-,41-34- |
| InChIKey | REEXCZBOGXTNGT-LMPHKIGQSA-N |
| XLogP | 8.76 |
| TPSA | 72.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.75 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|