C24H32ClN3O — CID 143531550
1-[4-(4-chlorophenyl)phenyl]-3-(2,2-dimethyl-4-piperidin-1-ylbutyl)urea (PubChem CID 143531550) has the molecular formula C24H32ClN3O and a molecular weight of 413.99 g/mol. Its IUPAC name is 1-[4-(4-chlorophenyl)phenyl]-3-(2,2-dimethyl-4-piperidin-1-ylbutyl)urea.
| Compound Name | 1-[4-(4-chlorophenyl)phenyl]-3-(2,2-dimethyl-4-piperidin-1-ylbutyl)urea |
|---|---|
| PubChem CID | 143531550 |
| Molecular Formula | C24H32ClN3O |
| Molecular Weight | 413.99 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | 1-[4-(4-chlorophenyl)phenyl]-3-(2,2-dimethyl-4-piperidin-1-ylbutyl)urea |
| SMILES | CC(C)(CCN1CCCCC1)CNC(=O)Nc1ccc(-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C24H32ClN3O/c1-24(2,14-17-28-15-4-3-5-16-28)18-26-23(29)27-22-12-8-20(9-13-22)19-6-10-21(25)11-7-19/h6-13H,3-5,14-18H2,1-2H3,(H2,26,27,29) |
| InChIKey | XXHFAEOPXLZOPJ-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.99 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |