C9H8ClF3N2O — CID 94863126
1-(4-chlorophenyl)-3-(2,2,2-trifluoroethyl)urea (PubChem CID 94863126) has the molecular formula C9H8ClF3N2O and a molecular weight of 252.62 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-(4-chlorophenyl)-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 94863126 |
| Molecular Formula | C9H8ClF3N2O |
| Molecular Weight | 252.62 g/mol |
| Exact Mass | 252.03 |
| IUPAC Name | 1-(4-chlorophenyl)-3-(2,2,2-trifluoroethyl)urea |
| SMILES | O=C(NCC(F)(F)F)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C9H8ClF3N2O/c10-6-1-3-7(4-2-6)15-8(16)14-5-9(11,12)13/h1-4H,5H2,(H2,14,15,16) |
| InChIKey | ARAAJAXHDXYEAH-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.62 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |