C10H9ClF3NO — CID 155941225
N-(4-chlorophenyl)-4,4,4-trifluorobutanamide (PubChem CID 155941225) has the molecular formula C10H9ClF3NO and a molecular weight of 251.63 g/mol. Its IUPAC name is N-(4-chlorophenyl)-4,4,4-trifluorobutanamide.
| Compound Name | N-(4-chlorophenyl)-4,4,4-trifluorobutanamide |
|---|---|
| PubChem CID | 155941225 |
| Molecular Formula | C10H9ClF3NO |
| Molecular Weight | 251.63 g/mol |
| Exact Mass | 251.03 |
| IUPAC Name | N-(4-chlorophenyl)-4,4,4-trifluorobutanamide |
| SMILES | O=C(CCC(F)(F)F)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C10H9ClF3NO/c11-7-1-3-8(4-2-7)15-9(16)5-6-10(12,13)14/h1-4H,5-6H2,(H,15,16) |
| InChIKey | AGRVEFBLEGGZQB-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.63 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |