C17H14Cl2N2O3 — CID 12654887
N,N'-bis(4-chlorophenyl)-3-oxopentanediamide (PubChem CID 12654887) has the molecular formula C17H14Cl2N2O3 and a molecular weight of 365.22 g/mol. Its IUPAC name is N,N'-bis(4-chlorophenyl)-3-oxopentanediamide.
| Compound Name | N,N'-bis(4-chlorophenyl)-3-oxopentanediamide |
|---|---|
| PubChem CID | 12654887 |
| Molecular Formula | C17H14Cl2N2O3 |
| Molecular Weight | 365.22 g/mol |
| Exact Mass | 364.04 |
| IUPAC Name | N,N'-bis(4-chlorophenyl)-3-oxopentanediamide |
| SMILES | O=C(CC(=O)Nc1ccc(Cl)cc1)CC(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H14Cl2N2O3/c18-11-1-5-13(6-2-11)20-16(23)9-15(22)10-17(24)21-14-7-3-12(19)4-8-14/h1-8H,9-10H2,(H,20,23)(H,21,24) |
| InChIKey | YSIZAQBOKBDRCW-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.22 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|