C17H14ClNO3 — CID 45103866
5-(4-chlorophenyl)-3,5-dioxo-N-phenylpentanamide (PubChem CID 45103866) has the molecular formula C17H14ClNO3 and a molecular weight of 315.76 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-3,5-dioxo-N-phenylpentanamide.
| Compound Name | 5-(4-chlorophenyl)-3,5-dioxo-N-phenylpentanamide |
|---|---|
| PubChem CID | 45103866 |
| Molecular Formula | C17H14ClNO3 |
| Molecular Weight | 315.76 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | 5-(4-chlorophenyl)-3,5-dioxo-N-phenylpentanamide |
| SMILES | O=C(CC(=O)Nc1ccccc1)CC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H14ClNO3/c18-13-8-6-12(7-9-13)16(21)10-15(20)11-17(22)19-14-4-2-1-3-5-14/h1-9H,10-11H2,(H,19,22) |
| InChIKey | WTRVMGWJADPPOF-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.76 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|