C16H15NO2 — CID 825307
4-oxo-N,4-diphenylbutanamide (PubChem CID 825307) has the molecular formula C16H15NO2 and a molecular weight of 253.30 g/mol. Its IUPAC name is 4-oxo-N,4-diphenylbutanamide.
| Compound Name | 4-oxo-N,4-diphenylbutanamide |
|---|---|
| PubChem CID | 825307 |
| Molecular Formula | C16H15NO2 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 4-oxo-N,4-diphenylbutanamide |
| SMILES | O=C(CCC(=O)c1ccccc1)Nc1ccccc1 |
| InChI | InChI=1S/C16H15NO2/c18-15(13-7-3-1-4-8-13)11-12-16(19)17-14-9-5-2-6-10-14/h1-10H,11-12H2,(H,17,19) |
| InChIKey | DFJJWGIIYISGIS-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |