C17H14FNO4 — CID 108795529
3-[[4-(4-fluorophenyl)-4-oxobutanoyl]amino]benzoic acid (PubChem CID 108795529) has the molecular formula C17H14FNO4 and a molecular weight of 315.30 g/mol. Its IUPAC name is 3-[[4-(4-fluorophenyl)-4-oxobutanoyl]amino]benzoic acid.
| Compound Name | 3-[[4-(4-fluorophenyl)-4-oxobutanoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 108795529 |
| Molecular Formula | C17H14FNO4 |
| Molecular Weight | 315.30 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 3-[[4-(4-fluorophenyl)-4-oxobutanoyl]amino]benzoic acid |
| SMILES | O=C(CCC(=O)c1ccc(F)cc1)Nc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C17H14FNO4/c18-13-6-4-11(5-7-13)15(20)8-9-16(21)19-14-3-1-2-12(10-14)17(22)23/h1-7,10H,8-9H2,(H,19,21)(H,22,23) |
| InChIKey | CJNGBCNOQSBNDZ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.30 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |