C19H22ClFN2O2 — CID 119438414
N-[3-(ethylaminomethyl)phenyl]-4-(4-fluorophenyl)-4-oxobutanamide;hydrochloride (PubChem CID 119438414) has the molecular formula C19H22ClFN2O2 and a molecular weight of 364.85 g/mol. Its IUPAC name is N-[3-(ethylaminomethyl)phenyl]-4-(4-fluorophenyl)-4-oxobutanamide;hydrochloride.
| Compound Name | N-[3-(ethylaminomethyl)phenyl]-4-(4-fluorophenyl)-4-oxobutanamide;hydrochloride |
|---|---|
| PubChem CID | 119438414 |
| Molecular Formula | C19H22ClFN2O2 |
| Molecular Weight | 364.85 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | N-[3-(ethylaminomethyl)phenyl]-4-(4-fluorophenyl)-4-oxobutanamide;hydrochloride |
| SMILES | CCNCc1cccc(NC(=O)CCC(=O)c2ccc(F)cc2)c1.Cl |
| InChI | InChI=1S/C19H21FN2O2.ClH/c1-2-21-13-14-4-3-5-17(12-14)22-19(24)11-10-18(23)15-6-8-16(20)9-7-15;/h3-9,12,21H,2,10-11,13H2,1H3,(H,22,24);1H |
| InChIKey | LVNAOMXVWWDJNV-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.85 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |