C20H23F2N3O2 — CID 119438363
N-[4-[3-(ethylaminomethyl)anilino]-4-oxobutyl]-2,4-difluorobenzamide (PubChem CID 119438363) has the molecular formula C20H23F2N3O2 and a molecular weight of 375.42 g/mol. Its IUPAC name is N-[4-[3-(ethylaminomethyl)anilino]-4-oxobutyl]-2,4-difluorobenzamide.
| Compound Name | N-[4-[3-(ethylaminomethyl)anilino]-4-oxobutyl]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 119438363 |
| Molecular Formula | C20H23F2N3O2 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | N-[4-[3-(ethylaminomethyl)anilino]-4-oxobutyl]-2,4-difluorobenzamide |
| SMILES | CCNCc1cccc(NC(=O)CCCNC(=O)c2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C20H23F2N3O2/c1-2-23-13-14-5-3-6-16(11-14)25-19(26)7-4-10-24-20(27)17-9-8-15(21)12-18(17)22/h3,5-6,8-9,11-12,23H,2,4,7,10,13H2,1H3,(H,24,27)(H,25,26) |
| InChIKey | KXKWUXIYWCLEFK-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|