C19H21F2N3O2 — CID 86932094
N-[3-[3-[(dimethylamino)methyl]anilino]-3-oxopropyl]-2,4-difluorobenzamide (PubChem CID 86932094) has the molecular formula C19H21F2N3O2 and a molecular weight of 361.39 g/mol. Its IUPAC name is N-[3-[3-[(dimethylamino)methyl]anilino]-3-oxopropyl]-2,4-difluorobenzamide.
| Compound Name | N-[3-[3-[(dimethylamino)methyl]anilino]-3-oxopropyl]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 86932094 |
| Molecular Formula | C19H21F2N3O2 |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | N-[3-[3-[(dimethylamino)methyl]anilino]-3-oxopropyl]-2,4-difluorobenzamide |
| SMILES | CN(C)Cc1cccc(NC(=O)CCNC(=O)c2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C19H21F2N3O2/c1-24(2)12-13-4-3-5-15(10-13)23-18(25)8-9-22-19(26)16-7-6-14(20)11-17(16)21/h3-7,10-11H,8-9,12H2,1-2H3,(H,22,26)(H,23,25) |
| InChIKey | SOCYQLJRFIVLRS-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |