C20H22F2N2O2 — CID 55376253
2,4-difluoro-N-[4-oxo-4-(3-propan-2-ylanilino)butyl]benzamide (PubChem CID 55376253) has the molecular formula C20H22F2N2O2 and a molecular weight of 360.40 g/mol. Its IUPAC name is 2,4-difluoro-N-[4-oxo-4-(3-propan-2-ylanilino)butyl]benzamide.
| Compound Name | 2,4-difluoro-N-[4-oxo-4-(3-propan-2-ylanilino)butyl]benzamide |
|---|---|
| PubChem CID | 55376253 |
| Molecular Formula | C20H22F2N2O2 |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 2,4-difluoro-N-[4-oxo-4-(3-propan-2-ylanilino)butyl]benzamide |
| SMILES | CC(C)c1cccc(NC(=O)CCCNC(=O)c2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C20H22F2N2O2/c1-13(2)14-5-3-6-16(11-14)24-19(25)7-4-10-23-20(26)17-9-8-15(21)12-18(17)22/h3,5-6,8-9,11-13H,4,7,10H2,1-2H3,(H,23,26)(H,24,25) |
| InChIKey | HNJMTWXUJODRKD-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.40 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|