C16H22F2N2O2 — CID 78803699
2,4-difluoro-N-[4-(3-methylbutylamino)-4-oxobutyl]benzamide (PubChem CID 78803699) has the molecular formula C16H22F2N2O2 and a molecular weight of 312.36 g/mol. Its IUPAC name is 2,4-difluoro-N-[4-(3-methylbutylamino)-4-oxobutyl]benzamide.
| Compound Name | 2,4-difluoro-N-[4-(3-methylbutylamino)-4-oxobutyl]benzamide |
|---|---|
| PubChem CID | 78803699 |
| Molecular Formula | C16H22F2N2O2 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 2,4-difluoro-N-[4-(3-methylbutylamino)-4-oxobutyl]benzamide |
| SMILES | CC(C)CCNC(=O)CCCNC(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C16H22F2N2O2/c1-11(2)7-9-19-15(21)4-3-8-20-16(22)13-6-5-12(17)10-14(13)18/h5-6,10-11H,3-4,7-9H2,1-2H3,(H,19,21)(H,20,22) |
| InChIKey | FAQHQFNMPKSZPI-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|