C14H16F2N2O4 — CID 119176967
3-[4-[(2,4-difluorobenzoyl)amino]butanoylamino]propanoic acid (PubChem CID 119176967) has the molecular formula C14H16F2N2O4 and a molecular weight of 314.29 g/mol. Its IUPAC name is 3-[4-[(2,4-difluorobenzoyl)amino]butanoylamino]propanoic acid.
| Compound Name | 3-[4-[(2,4-difluorobenzoyl)amino]butanoylamino]propanoic acid |
|---|---|
| PubChem CID | 119176967 |
| Molecular Formula | C14H16F2N2O4 |
| Molecular Weight | 314.29 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 3-[4-[(2,4-difluorobenzoyl)amino]butanoylamino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)CCCNC(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C14H16F2N2O4/c15-9-3-4-10(11(16)8-9)14(22)18-6-1-2-12(19)17-7-5-13(20)21/h3-4,8H,1-2,5-7H2,(H,17,19)(H,18,22)(H,20,21) |
| InChIKey | RJNWGAMJBGQNKS-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.29 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|