C18H18F2N2O2 — CID 29414441
N-[4-(benzylamino)-4-oxobutyl]-2,4-difluorobenzamide (PubChem CID 29414441) has the molecular formula C18H18F2N2O2 and a molecular weight of 332.35 g/mol. Its IUPAC name is N-[4-(benzylamino)-4-oxobutyl]-2,4-difluorobenzamide.
| Compound Name | N-[4-(benzylamino)-4-oxobutyl]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 29414441 |
| Molecular Formula | C18H18F2N2O2 |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | N-[4-(benzylamino)-4-oxobutyl]-2,4-difluorobenzamide |
| SMILES | O=C(CCCNC(=O)c1ccc(F)cc1F)NCc1ccccc1 |
| InChI | InChI=1S/C18H18F2N2O2/c19-14-8-9-15(16(20)11-14)18(24)21-10-4-7-17(23)22-12-13-5-2-1-3-6-13/h1-3,5-6,8-9,11H,4,7,10,12H2,(H,21,24)(H,22,23) |
| InChIKey | VHWYLBOJBLJNLB-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|