C21H20F2N2O5 — CID 30319864
[2-oxo-2-[(2-phenylacetyl)amino]ethyl] 4-[(2,4-difluorobenzoyl)amino]butanoate (PubChem CID 30319864) has the molecular formula C21H20F2N2O5 and a molecular weight of 418.40 g/mol. Its IUPAC name is [2-oxo-2-[(2-phenylacetyl)amino]ethyl] 4-[(2,4-difluorobenzoyl)amino]butanoate.
| Compound Name | [2-oxo-2-[(2-phenylacetyl)amino]ethyl] 4-[(2,4-difluorobenzoyl)amino]butanoate |
|---|---|
| PubChem CID | 30319864 |
| Molecular Formula | C21H20F2N2O5 |
| Molecular Weight | 418.40 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | [2-oxo-2-[(2-phenylacetyl)amino]ethyl] 4-[(2,4-difluorobenzoyl)amino]butanoate |
| SMILES | O=C(COC(=O)CCCNC(=O)c1ccc(F)cc1F)NC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C21H20F2N2O5/c22-15-8-9-16(17(23)12-15)21(29)24-10-4-7-20(28)30-13-19(27)25-18(26)11-14-5-2-1-3-6-14/h1-3,5-6,8-9,12H,4,7,10-11,13H2,(H,24,29)(H,25,26,27) |
| InChIKey | SHWRUMTWIBFJDS-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.40 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|