C18H15F2IN2O4 — CID 30316908
[2-(3-iodoanilino)-2-oxoethyl] 3-[(2,4-difluorobenzoyl)amino]propanoate (PubChem CID 30316908) has the molecular formula C18H15F2IN2O4 and a molecular weight of 488.23 g/mol. Its IUPAC name is [2-(3-iodoanilino)-2-oxoethyl] 3-[(2,4-difluorobenzoyl)amino]propanoate.
| Compound Name | [2-(3-iodoanilino)-2-oxoethyl] 3-[(2,4-difluorobenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 30316908 |
| Molecular Formula | C18H15F2IN2O4 |
| Molecular Weight | 488.23 g/mol |
| Exact Mass | 488.00 |
| IUPAC Name | [2-(3-iodoanilino)-2-oxoethyl] 3-[(2,4-difluorobenzoyl)amino]propanoate |
| SMILES | O=C(COC(=O)CCNC(=O)c1ccc(F)cc1F)Nc1cccc(I)c1 |
| InChI | InChI=1S/C18H15F2IN2O4/c19-11-4-5-14(15(20)8-11)18(26)22-7-6-17(25)27-10-16(24)23-13-3-1-2-12(21)9-13/h1-5,8-9H,6-7,10H2,(H,22,26)(H,23,24) |
| InChIKey | BVJPRMANUOSXGR-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.23 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|