C19H18F2N2O5 — CID 30316161
[2-(2-methoxyanilino)-2-oxoethyl] 3-[(2,4-difluorobenzoyl)amino]propanoate (PubChem CID 30316161) has the molecular formula C19H18F2N2O5 and a molecular weight of 392.36 g/mol. Its IUPAC name is [2-(2-methoxyanilino)-2-oxoethyl] 3-[(2,4-difluorobenzoyl)amino]propanoate.
| Compound Name | [2-(2-methoxyanilino)-2-oxoethyl] 3-[(2,4-difluorobenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 30316161 |
| Molecular Formula | C19H18F2N2O5 |
| Molecular Weight | 392.36 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | [2-(2-methoxyanilino)-2-oxoethyl] 3-[(2,4-difluorobenzoyl)amino]propanoate |
| SMILES | COc1ccccc1NC(=O)COC(=O)CCNC(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C19H18F2N2O5/c1-27-16-5-3-2-4-15(16)23-17(24)11-28-18(25)8-9-22-19(26)13-7-6-12(20)10-14(13)21/h2-7,10H,8-9,11H2,1H3,(H,22,26)(H,23,24) |
| InChIKey | CXCIWXHOIBYJIQ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.36 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |