C21H24N2O7 — CID 7827506
[2-(2,4-dimethoxyanilino)-2-oxoethyl] 3-[(2-methoxybenzoyl)amino]propanoate (PubChem CID 7827506) has the molecular formula C21H24N2O7 and a molecular weight of 416.43 g/mol. Its IUPAC name is [2-(2,4-dimethoxyanilino)-2-oxoethyl] 3-[(2-methoxybenzoyl)amino]propanoate.
| Compound Name | [2-(2,4-dimethoxyanilino)-2-oxoethyl] 3-[(2-methoxybenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 7827506 |
| Molecular Formula | C21H24N2O7 |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | [2-(2,4-dimethoxyanilino)-2-oxoethyl] 3-[(2-methoxybenzoyl)amino]propanoate |
| SMILES | COc1ccc(NC(=O)COC(=O)CCNC(=O)c2ccccc2OC)c(OC)c1 |
| InChI | InChI=1S/C21H24N2O7/c1-27-14-8-9-16(18(12-14)29-3)23-19(24)13-30-20(25)10-11-22-21(26)15-6-4-5-7-17(15)28-2/h4-9,12H,10-11,13H2,1-3H3,(H,22,26)(H,23,24) |
| InChIKey | WJUZFQHPIYSRHE-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 112.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |