C23H21FN2O5 — CID 26735156
N-(2,4-dimethoxyphenyl)-2-[2-(2-fluoroanilino)-2-oxoethoxy]benzamide (PubChem CID 26735156) has the molecular formula C23H21FN2O5 and a molecular weight of 424.43 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-2-[2-(2-fluoroanilino)-2-oxoethoxy]benzamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-2-[2-(2-fluoroanilino)-2-oxoethoxy]benzamide |
|---|---|
| PubChem CID | 26735156 |
| Molecular Formula | C23H21FN2O5 |
| Molecular Weight | 424.43 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-2-[2-(2-fluoroanilino)-2-oxoethoxy]benzamide |
| SMILES | COc1ccc(NC(=O)c2ccccc2OCC(=O)Nc2ccccc2F)c(OC)c1 |
| InChI | InChI=1S/C23H21FN2O5/c1-29-15-11-12-19(21(13-15)30-2)26-23(28)16-7-3-6-10-20(16)31-14-22(27)25-18-9-5-4-8-17(18)24/h3-13H,14H2,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | DWNQHJILAASNPQ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.43 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |