C25H24ClN3O6 — CID 27681196
N-(4-chloro-2-methoxyphenyl)-2-[2-[[[2-(4-methoxyphenyl)acetyl]amino]carbamoyl]phenoxy]acetamide (PubChem CID 27681196) has the molecular formula C25H24ClN3O6 and a molecular weight of 497.94 g/mol. Its IUPAC name is N-(4-chloro-2-methoxyphenyl)-2-[2-[[[2-(4-methoxyphenyl)acetyl]amino]carbamoyl]phenoxy]acetamide.
| Compound Name | N-(4-chloro-2-methoxyphenyl)-2-[2-[[[2-(4-methoxyphenyl)acetyl]amino]carbamoyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 27681196 |
| Molecular Formula | C25H24ClN3O6 |
| Molecular Weight | 497.94 g/mol |
| Exact Mass | 497.14 |
| IUPAC Name | N-(4-chloro-2-methoxyphenyl)-2-[2-[[[2-(4-methoxyphenyl)acetyl]amino]carbamoyl]phenoxy]acetamide |
| SMILES | COc1ccc(CC(=O)NNC(=O)c2ccccc2OCC(=O)Nc2ccc(Cl)cc2OC)cc1 |
| InChI | InChI=1S/C25H24ClN3O6/c1-33-18-10-7-16(8-11-18)13-23(30)28-29-25(32)19-5-3-4-6-21(19)35-15-24(31)27-20-12-9-17(26)14-22(20)34-2/h3-12,14H,13,15H2,1-2H3,(H,27,31)(H,28,30)(H,29,32) |
| InChIKey | JSYHOJJBHHQEJA-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.94 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|