C25H25ClN4O5 — CID 27681200
N-(4-chloro-2-methoxyphenyl)-2-[2-[[[3-(dimethylamino)benzoyl]amino]carbamoyl]phenoxy]acetamide (PubChem CID 27681200) has the molecular formula C25H25ClN4O5 and a molecular weight of 496.95 g/mol. Its IUPAC name is N-(4-chloro-2-methoxyphenyl)-2-[2-[[[3-(dimethylamino)benzoyl]amino]carbamoyl]phenoxy]acetamide.
| Compound Name | N-(4-chloro-2-methoxyphenyl)-2-[2-[[[3-(dimethylamino)benzoyl]amino]carbamoyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 27681200 |
| Molecular Formula | C25H25ClN4O5 |
| Molecular Weight | 496.95 g/mol |
| Exact Mass | 496.15 |
| IUPAC Name | N-(4-chloro-2-methoxyphenyl)-2-[2-[[[3-(dimethylamino)benzoyl]amino]carbamoyl]phenoxy]acetamide |
| SMILES | COc1cc(Cl)ccc1NC(=O)COc1ccccc1C(=O)NNC(=O)c1cccc(N(C)C)c1 |
| InChI | InChI=1S/C25H25ClN4O5/c1-30(2)18-8-6-7-16(13-18)24(32)28-29-25(33)19-9-4-5-10-21(19)35-15-23(31)27-20-12-11-17(26)14-22(20)34-3/h4-14H,15H2,1-3H3,(H,27,31)(H,28,32)(H,29,33) |
| InChIKey | JTDLGZPRVKWJSH-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.95 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|