C15H13ClN2O3 — CID 34594179
N'-benzoyl-4-chloro-2-methoxybenzohydrazide (PubChem CID 34594179) has the molecular formula C15H13ClN2O3 and a molecular weight of 304.73 g/mol. Its IUPAC name is N'-benzoyl-4-chloro-2-methoxybenzohydrazide.
| Compound Name | N'-benzoyl-4-chloro-2-methoxybenzohydrazide |
|---|---|
| PubChem CID | 34594179 |
| Molecular Formula | C15H13ClN2O3 |
| Molecular Weight | 304.73 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | N'-benzoyl-4-chloro-2-methoxybenzohydrazide |
| SMILES | COc1cc(Cl)ccc1C(=O)NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C15H13ClN2O3/c1-21-13-9-11(16)7-8-12(13)15(20)18-17-14(19)10-5-3-2-4-6-10/h2-9H,1H3,(H,17,19)(H,18,20) |
| InChIKey | BFUUVRMDOBLAAE-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.73 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|