C18H16ClN5O3 — CID 30760557
4-chloro-2-methoxy-N'-[4-(1,2,4-triazol-1-ylmethyl)benzoyl]benzohydrazide (PubChem CID 30760557) has the molecular formula C18H16ClN5O3 and a molecular weight of 385.81 g/mol. Its IUPAC name is 4-chloro-2-methoxy-N'-[4-(1,2,4-triazol-1-ylmethyl)benzoyl]benzohydrazide.
| Compound Name | 4-chloro-2-methoxy-N'-[4-(1,2,4-triazol-1-ylmethyl)benzoyl]benzohydrazide |
|---|---|
| PubChem CID | 30760557 |
| Molecular Formula | C18H16ClN5O3 |
| Molecular Weight | 385.81 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | 4-chloro-2-methoxy-N'-[4-(1,2,4-triazol-1-ylmethyl)benzoyl]benzohydrazide |
| SMILES | COc1cc(Cl)ccc1C(=O)NNC(=O)c1ccc(Cn2cncn2)cc1 |
| InChI | InChI=1S/C18H16ClN5O3/c1-27-16-8-14(19)6-7-15(16)18(26)23-22-17(25)13-4-2-12(3-5-13)9-24-11-20-10-21-24/h2-8,10-11H,9H2,1H3,(H,22,25)(H,23,26) |
| InChIKey | OUAFJZDIJHASHB-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.81 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|