C19H18ClN5O2 — CID 55659343
2-chloro-N-[2-[[4-(1,2,4-triazol-1-ylmethyl)benzoyl]amino]ethyl]benzamide (PubChem CID 55659343) has the molecular formula C19H18ClN5O2 and a molecular weight of 383.84 g/mol. Its IUPAC name is 2-chloro-N-[2-[[4-(1,2,4-triazol-1-ylmethyl)benzoyl]amino]ethyl]benzamide.
| Compound Name | 2-chloro-N-[2-[[4-(1,2,4-triazol-1-ylmethyl)benzoyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 55659343 |
| Molecular Formula | C19H18ClN5O2 |
| Molecular Weight | 383.84 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | 2-chloro-N-[2-[[4-(1,2,4-triazol-1-ylmethyl)benzoyl]amino]ethyl]benzamide |
| SMILES | O=C(NCCNC(=O)c1ccccc1Cl)c1ccc(Cn2cncn2)cc1 |
| InChI | InChI=1S/C19H18ClN5O2/c20-17-4-2-1-3-16(17)19(27)23-10-9-22-18(26)15-7-5-14(6-8-15)11-25-13-21-12-24-25/h1-8,12-13H,9-11H2,(H,22,26)(H,23,27) |
| InChIKey | SAQUKNVNMZVUQU-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.84 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|