C17H16N4O2 — CID 18132348
2-hydroxy-N-[[4-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]benzamide (PubChem CID 18132348) has the molecular formula C17H16N4O2 and a molecular weight of 308.34 g/mol. Its IUPAC name is 2-hydroxy-N-[[4-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]benzamide.
| Compound Name | 2-hydroxy-N-[[4-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 18132348 |
| Molecular Formula | C17H16N4O2 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 2-hydroxy-N-[[4-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]benzamide |
| SMILES | O=C(NCc1ccc(Cn2cncn2)cc1)c1ccccc1O |
| InChI | InChI=1S/C17H16N4O2/c22-16-4-2-1-3-15(16)17(23)19-9-13-5-7-14(8-6-13)10-21-12-18-11-20-21/h1-8,11-12,22H,9-10H2,(H,19,23) |
| InChIKey | TXTVAODZOQUVIC-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |