C16H15ClN2O4 — CID 29279191
4-chloro-2-methoxy-N'-(2-phenoxyacetyl)benzohydrazide (PubChem CID 29279191) has the molecular formula C16H15ClN2O4 and a molecular weight of 334.76 g/mol. Its IUPAC name is 4-chloro-2-methoxy-N'-(2-phenoxyacetyl)benzohydrazide.
| Compound Name | 4-chloro-2-methoxy-N'-(2-phenoxyacetyl)benzohydrazide |
|---|---|
| PubChem CID | 29279191 |
| Molecular Formula | C16H15ClN2O4 |
| Molecular Weight | 334.76 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | 4-chloro-2-methoxy-N'-(2-phenoxyacetyl)benzohydrazide |
| SMILES | COc1cc(Cl)ccc1C(=O)NNC(=O)COc1ccccc1 |
| InChI | InChI=1S/C16H15ClN2O4/c1-22-14-9-11(17)7-8-13(14)16(21)19-18-15(20)10-23-12-5-3-2-4-6-12/h2-9H,10H2,1H3,(H,18,20)(H,19,21) |
| InChIKey | FCYORLUQVPCSBW-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.76 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|