C23H18ClN3O4 — CID 31863120
4-chloro-2-methoxy-N'-[2-(9-oxoacridin-10-yl)acetyl]benzohydrazide (PubChem CID 31863120) has the molecular formula C23H18ClN3O4 and a molecular weight of 435.87 g/mol. Its IUPAC name is 4-chloro-2-methoxy-N'-[2-(9-oxoacridin-10-yl)acetyl]benzohydrazide.
| Compound Name | 4-chloro-2-methoxy-N'-[2-(9-oxoacridin-10-yl)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 31863120 |
| Molecular Formula | C23H18ClN3O4 |
| Molecular Weight | 435.87 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | 4-chloro-2-methoxy-N'-[2-(9-oxoacridin-10-yl)acetyl]benzohydrazide |
| SMILES | COc1cc(Cl)ccc1C(=O)NNC(=O)Cn1c2ccccc2c(=O)c2ccccc21 |
| InChI | InChI=1S/C23H18ClN3O4/c1-31-20-12-14(24)10-11-17(20)23(30)26-25-21(28)13-27-18-8-4-2-6-15(18)22(29)16-7-3-5-9-19(16)27/h2-12H,13H2,1H3,(H,25,28)(H,26,30) |
| InChIKey | SMWVFQPCMYIRGD-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 89.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.87 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|