C24H21N3O3 — CID 16605618
4-ethyl-N'-[2-(9-oxoacridin-10-yl)acetyl]benzohydrazide (PubChem CID 16605618) has the molecular formula C24H21N3O3 and a molecular weight of 399.45 g/mol. Its IUPAC name is 4-ethyl-N'-[2-(9-oxoacridin-10-yl)acetyl]benzohydrazide.
| Compound Name | 4-ethyl-N'-[2-(9-oxoacridin-10-yl)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 16605618 |
| Molecular Formula | C24H21N3O3 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | 4-ethyl-N'-[2-(9-oxoacridin-10-yl)acetyl]benzohydrazide |
| SMILES | CCc1ccc(C(=O)NNC(=O)Cn2c3ccccc3c(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C24H21N3O3/c1-2-16-11-13-17(14-12-16)24(30)26-25-22(28)15-27-20-9-5-3-7-18(20)23(29)19-8-4-6-10-21(19)27/h3-14H,2,15H2,1H3,(H,25,28)(H,26,30) |
| InChIKey | SYBQAKZAHHZOOK-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|