C23H17F3N2O2 — CID 134051518
2-(9-oxoacridin-10-yl)-N-[[4-(trifluoromethyl)phenyl]methyl]acetamide (PubChem CID 134051518) has the molecular formula C23H17F3N2O2 and a molecular weight of 410.40 g/mol. Its IUPAC name is 2-(9-oxoacridin-10-yl)-N-[[4-(trifluoromethyl)phenyl]methyl]acetamide.
| Compound Name | 2-(9-oxoacridin-10-yl)-N-[[4-(trifluoromethyl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 134051518 |
| Molecular Formula | C23H17F3N2O2 |
| Molecular Weight | 410.40 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | 2-(9-oxoacridin-10-yl)-N-[[4-(trifluoromethyl)phenyl]methyl]acetamide |
| SMILES | O=C(Cn1c2ccccc2c(=O)c2ccccc21)NCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H17F3N2O2/c24-23(25,26)16-11-9-15(10-12-16)13-27-21(29)14-28-19-7-3-1-5-17(19)22(30)18-6-2-4-8-20(18)28/h1-12H,13-14H2,(H,27,29) |
| InChIKey | DNHRHLGFEYVTAC-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.40 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|