C15H12F3NO — CID 22225397
N-[[4-(trifluoromethyl)phenyl]methyl]benzamide (PubChem CID 22225397) has the molecular formula C15H12F3NO and a molecular weight of 279.26 g/mol. Its IUPAC name is N-[[4-(trifluoromethyl)phenyl]methyl]benzamide.
| Compound Name | N-[[4-(trifluoromethyl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 22225397 |
| Molecular Formula | C15H12F3NO |
| Molecular Weight | 279.26 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | N-[[4-(trifluoromethyl)phenyl]methyl]benzamide |
| SMILES | O=C(NCc1ccc(C(F)(F)F)cc1)c1ccccc1 |
| InChI | InChI=1S/C15H12F3NO/c16-15(17,18)13-8-6-11(7-9-13)10-19-14(20)12-4-2-1-3-5-12/h1-9H,10H2,(H,19,20) |
| InChIKey | TVRICLUZZAEKQL-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.26 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |