C17H12F3N3O — CID 68959282
N-[[4-(trifluoromethyl)phenyl]methyl]cyclohepta[c]pyrazole-3-carboxamide (PubChem CID 68959282) has the molecular formula C17H12F3N3O and a molecular weight of 331.30 g/mol. Its IUPAC name is N-[[4-(trifluoromethyl)phenyl]methyl]cyclohepta[c]pyrazole-3-carboxamide.
| Compound Name | N-[[4-(trifluoromethyl)phenyl]methyl]cyclohepta[c]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 68959282 |
| Molecular Formula | C17H12F3N3O |
| Molecular Weight | 331.30 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | N-[[4-(trifluoromethyl)phenyl]methyl]cyclohepta[c]pyrazole-3-carboxamide |
| SMILES | O=C(NCc1ccc(C(F)(F)F)cc1)c1nnc2cccccc1-2 |
| InChI | InChI=1S/C17H12F3N3O/c18-17(19,20)12-8-6-11(7-9-12)10-21-16(24)15-13-4-2-1-3-5-14(13)22-23-15/h1-9H,10H2,(H,21,24) |
| InChIKey | GMFGGZIVJIIAOL-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.30 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |