C18H18F3N3O2 — CID 18164591
2-(carbamoylamino)-3-phenyl-N-[[4-(trifluoromethyl)phenyl]methyl]propanamide (PubChem CID 18164591) has the molecular formula C18H18F3N3O2 and a molecular weight of 365.36 g/mol. Its IUPAC name is 2-(carbamoylamino)-3-phenyl-N-[[4-(trifluoromethyl)phenyl]methyl]propanamide.
| Compound Name | 2-(carbamoylamino)-3-phenyl-N-[[4-(trifluoromethyl)phenyl]methyl]propanamide |
|---|---|
| PubChem CID | 18164591 |
| Molecular Formula | C18H18F3N3O2 |
| Molecular Weight | 365.36 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 2-(carbamoylamino)-3-phenyl-N-[[4-(trifluoromethyl)phenyl]methyl]propanamide |
| SMILES | NC(=O)NC(Cc1ccccc1)C(=O)NCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H18F3N3O2/c19-18(20,21)14-8-6-13(7-9-14)11-23-16(25)15(24-17(22)26)10-12-4-2-1-3-5-12/h1-9,15H,10-11H2,(H,23,25)(H3,22,24,26) |
| InChIKey | SBBVEWHHSLWKOX-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.36 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |