C26H25F3N2O3 — CID 123411994
N-benzyl-2-[[2-(4-methoxyphenyl)acetyl]amino]-3-[3-(trifluoromethyl)phenyl]propanamide (PubChem CID 123411994) has the molecular formula C26H25F3N2O3 and a molecular weight of 470.49 g/mol. Its IUPAC name is N-benzyl-2-[[2-(4-methoxyphenyl)acetyl]amino]-3-[3-(trifluoromethyl)phenyl]propanamide.
| Compound Name | N-benzyl-2-[[2-(4-methoxyphenyl)acetyl]amino]-3-[3-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 123411994 |
| Molecular Formula | C26H25F3N2O3 |
| Molecular Weight | 470.49 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | N-benzyl-2-[[2-(4-methoxyphenyl)acetyl]amino]-3-[3-(trifluoromethyl)phenyl]propanamide |
| SMILES | COc1ccc(CC(=O)NC(Cc2cccc(C(F)(F)F)c2)C(=O)NCc2ccccc2)cc1 |
| InChI | InChI=1S/C26H25F3N2O3/c1-34-22-12-10-18(11-13-22)16-24(32)31-23(25(33)30-17-19-6-3-2-4-7-19)15-20-8-5-9-21(14-20)26(27,28)29/h2-14,23H,15-17H2,1H3,(H,30,33)(H,31,32) |
| InChIKey | DHFQEGCIYXIHAQ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.49 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |