C27H26N2O4 — CID 147411654
(2S)-3-(1-benzofuran-2-yl)-N-benzyl-2-[[2-(4-methoxyphenyl)acetyl]amino]propanamide (PubChem CID 147411654) has the molecular formula C27H26N2O4 and a molecular weight of 442.52 g/mol. Its IUPAC name is (2S)-3-(1-benzofuran-2-yl)-N-benzyl-2-[[2-(4-methoxyphenyl)acetyl]amino]propanamide.
| Compound Name | (2S)-3-(1-benzofuran-2-yl)-N-benzyl-2-[[2-(4-methoxyphenyl)acetyl]amino]propanamide |
|---|---|
| PubChem CID | 147411654 |
| Molecular Formula | C27H26N2O4 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | (2S)-3-(1-benzofuran-2-yl)-N-benzyl-2-[[2-(4-methoxyphenyl)acetyl]amino]propanamide |
| SMILES | COc1ccc(CC(=O)N[C@@H](Cc2cc3ccccc3o2)C(=O)NCc2ccccc2)cc1 |
| InChI | InChI=1S/C27H26N2O4/c1-32-22-13-11-19(12-14-22)15-26(30)29-24(27(31)28-18-20-7-3-2-4-8-20)17-23-16-21-9-5-6-10-25(21)33-23/h2-14,16,24H,15,17-18H2,1H3,(H,28,31)(H,29,30)/t24-/m0/s1 |
| InChIKey | DQSMIULDMIEKDT-DEOSSOPVSA-N |
| XLogP | 4.03 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |