C20H19NO5 — CID 86655478
methyl (2S)-2-(1-benzofuran-2-carbonylamino)-3-(4-methoxyphenyl)propanoate (PubChem CID 86655478) has the molecular formula C20H19NO5 and a molecular weight of 353.37 g/mol. Its IUPAC name is methyl (2S)-2-(1-benzofuran-2-carbonylamino)-3-(4-methoxyphenyl)propanoate.
| Compound Name | methyl (2S)-2-(1-benzofuran-2-carbonylamino)-3-(4-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 86655478 |
| Molecular Formula | C20H19NO5 |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | methyl (2S)-2-(1-benzofuran-2-carbonylamino)-3-(4-methoxyphenyl)propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(OC)cc1)NC(=O)c1cc2ccccc2o1 |
| InChI | InChI=1S/C20H19NO5/c1-24-15-9-7-13(8-10-15)11-16(20(23)25-2)21-19(22)18-12-14-5-3-4-6-17(14)26-18/h3-10,12,16H,11H2,1-2H3,(H,21,22)/t16-/m0/s1 |
| InChIKey | OPXMMOYNFVTIDY-INIZCTEOSA-N |
| XLogP | 2.96 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |